CAS 24396-82-5 appears in our catalog under these names: Clofazimine Impurity 5, Clofazimine Impurity 2. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
3-N,10-bis(4-chlorophenyl)-2-N-propan-2-yl-2H-phenazine-2,3-diamine (CAS 24396-82-5) is a chemical compound with the molecular formula C27H24Cl2N4 and a molecular weight of 475.4 g/mol. IUPAC name: 3-N,10-bis(4-chlorophenyl)-2-N-propan-2-yl-2H-phenazine-2,3-diamine. InChIKey: UVLLBQDWHSIVDU-UHFFFAOYSA-N.
| Molecular formula | C27H24Cl2N4 |
|---|---|
| Molecular weight | 475.4 g/mol |
| IUPAC name | 3-N,10-bis(4-chlorophenyl)-2-N-propan-2-yl-2H-phenazine-2,3-diamine |
| InChIKey | UVLLBQDWHSIVDU-UHFFFAOYSA-N |
| SMILES | CC(C)NC1C=C2C(=NC3=CC=CC=C3N2C4=CC=C(C=C4)Cl)C=C1NC5=CC=C(C=C5)Cl |
Computed by PubChem (NCBI)