CAS 243987-05-5 is the registry number for 4,6-Dithien-2-yl-2-thioxo-1,2-dihydropyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-sulfanylidene-4,6-dithiophen-2-yl-1H-pyridine-3-carbonitrile (CAS 243987-05-5) is a chemical compound with the molecular formula C14H8N2S3 and a molecular weight of 300.4 g/mol. IUPAC name: 2-sulfanylidene-4,6-dithiophen-2-yl-1H-pyridine-3-carbonitrile. InChIKey: YLAJZDWKZNBCSL-UHFFFAOYSA-N.
| Molecular formula | C14H8N2S3 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 2-sulfanylidene-4,6-dithiophen-2-yl-1H-pyridine-3-carbonitrile |
| InChIKey | YLAJZDWKZNBCSL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=C(C(=S)N2)C#N)C3=CC=CS3 |
Computed by PubChem (NCBI)