Products 2440027-77-8
CAS 2440027-77-8 is the registry number for THR-β agonist 2, 99.31%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 25 mg, 5 mg, 10mM/1mL, 50 mg.
2-[3,5-dichloro-4-[(4-oxo-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile (CAS 2440027-77-8) is a chemical compound with the molecular formula C18H8Cl2N6O4 and a molecular weight of 443.2 g/mol. IUPAC name: 2-[3,5-dichloro-4-[(4-oxo-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile. InChIKey: FJQQQWSZHAKGKZ-UHFFFAOYSA-N.
| Molecular formula | C18H8Cl2N6O4 |
|---|---|
| Molecular weight | 443.2 g/mol |
| IUPAC name | 2-[3,5-dichloro-4-[(4-oxo-3H-phthalazin-1-yl)oxy]phenyl]-3,5-dioxo-1,2,4-triazine-6-carbonitrile |
| InChIKey | FJQQQWSZHAKGKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NN=C2OC3=C(C=C(C=C3Cl)N4C(=O)NC(=O)C(=N4)C#N)Cl |
Computed by PubChem (NCBI)