Products 2440199-22-2

CAS 2440199-22-2 is the registry number for 1-Benzyl 4-(tert-butyl) 2-(bromomethyl)-1,4-diazepane-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-benzyl 4-O-tert-butyl 2-(bromomethyl)-1,4-diazepane-1,4-dicarboxylate (CAS 2440199-22-2) is a chemical compound with the molecular formula C19H27BrN2O4 and a molecular weight of 427.3 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl 2-(bromomethyl)-1,4-diazepane-1,4-dicarboxylate. InChIKey: CBEYLKFPNGYBSS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H27BrN2O4
Molecular weight427.3 g/mol
IUPAC name1-O-benzyl 4-O-tert-butyl 2-(bromomethyl)-1,4-diazepane-1,4-dicarboxylate
InChIKeyCBEYLKFPNGYBSS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCN(C(C1)CBr)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)