CAS 244028-70-4 appears in our catalog under these names: Fmoc–D–Tyr(3–I)–OH, Fmoc-3-iodo-D-tyrosine, Fmoc-D-Tyr(3-I)-OH 95%, Fmoc-D-Tyr(3-I)-OH, 95%, 95%, Fmoc-D-Tyr(3-I)-OH, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2g, 50g, 25g, 250mg, 100mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-iodophenyl)propanoic acid (CAS 244028-70-4) is a chemical compound with the molecular formula C24H20INO5 and a molecular weight of 529.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-iodophenyl)propanoic acid. InChIKey: ZRJAMVZQFHAZAE-OAQYLSRUSA-N.
| Molecular formula | C24H20INO5 |
|---|---|
| Molecular weight | 529.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| InChIKey | ZRJAMVZQFHAZAE-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=C(C=C4)O)I)C(=O)O |
Computed by PubChem (NCBI)