CAS 244048-96-2 is the registry number for N,N-Diethyl-cis-2,6-dimethylpiperidiumhydroxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,6R)-1,1-diethyl-2,6-dimethylpiperidin-1-ium hydroxide (CAS 244048-96-2) is a chemical compound with the molecular formula C11H25NO and a molecular weight of 187.32 g/mol. IUPAC name: (2S,6R)-1,1-diethyl-2,6-dimethylpiperidin-1-ium hydroxide. InChIKey: YITHLEHDZCSGKF-NJJJQDLFSA-M.
| Molecular formula | C11H25NO |
|---|---|
| Molecular weight | 187.32 g/mol |
| IUPAC name | (2S,6R)-1,1-diethyl-2,6-dimethylpiperidin-1-ium hydroxide |
| InChIKey | YITHLEHDZCSGKF-NJJJQDLFSA-M |
| SMILES | CC[N+]1([C@@H](CCC[C@@H]1C)C)CC.[OH-] |
Computed by PubChem (NCBI)