CAS 24407-32-7 appears in our catalog under these names: 3,4,5,6-Tetrabromophthalimide, 95%, 4,5,6,7–Tetrabromoisoindoline–1,3–dione, 4,5,6,7-Tetrabromoisoindoline-1,3-dione 97%, 4,5,6,7-Tetrabromoisoindoline-1,3-dione, 97%, 97%, 4,5,6,7-Tetrabromoisoindoline-1,3-dione, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
4,5,6,7-tetrabromoisoindole-1,3-dione (CAS 24407-32-7) is a chemical compound with the molecular formula C8HBr4NO2 and a molecular weight of 462.71 g/mol. IUPAC name: 4,5,6,7-tetrabromoisoindole-1,3-dione. InChIKey: QRFTXHFUNIFHST-UHFFFAOYSA-N.
| Molecular formula | C8HBr4NO2 |
|---|---|
| Molecular weight | 462.71 g/mol |
| IUPAC name | 4,5,6,7-tetrabromoisoindole-1,3-dione |
| InChIKey | QRFTXHFUNIFHST-UHFFFAOYSA-N |
| SMILES | C12=C(C(=C(C(=C1Br)Br)Br)Br)C(=O)NC2=O |
Computed by PubChem (NCBI)