CAS 244092-63-5 is the registry number for (S)–1–Phenylprop–2–en–1–amine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(1S)-1-phenylprop-2-en-1-amine;hydrochloride (CAS 244092-63-5) is a chemical compound with the molecular formula C9H12ClN and a molecular weight of 169.65 g/mol. IUPAC name: (1S)-1-phenylprop-2-en-1-amine;hydrochloride. InChIKey: SMLXICHDYHVTSX-FVGYRXGTSA-N.
| Molecular formula | C9H12ClN |
|---|---|
| Molecular weight | 169.65 g/mol |
| IUPAC name | (1S)-1-phenylprop-2-en-1-amine;hydrochloride |
| InChIKey | SMLXICHDYHVTSX-FVGYRXGTSA-N |
| SMILES | C=C[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)