CAS 244126-64-5 appears in our catalog under these names: 5-(Trifluoromethyl)-1-benzothiophene-2-carboxylic acid, 95%, 5-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid 96%, 5-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg.
5-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid (CAS 244126-64-5) is a chemical compound with the molecular formula C10H5F3O2S and a molecular weight of 246.21 g/mol. IUPAC name: 5-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid. InChIKey: ROIKYRUNAMGSHG-UHFFFAOYSA-N.
| Molecular formula | C10H5F3O2S |
|---|---|
| Molecular weight | 246.21 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1-benzothiophene-2-carboxylic acid |
| InChIKey | ROIKYRUNAMGSHG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C=C(S2)C(=O)O |
Computed by PubChem (NCBI)