Products 24424-95-1
CAS 24424-95-1 is the registry number for Di-tert-butyl tricarbonate, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Bis[(2-methylpropan-2-yl)oxycarbonyl] carbonate (CAS 24424-95-1) is a chemical compound with the molecular formula C11H18O7 and a molecular weight of 262.26 g/mol. IUPAC name: bis[(2-methylpropan-2-yl)oxycarbonyl] carbonate. InChIKey: YZVKCRIFBGZDNI-UHFFFAOYSA-N.
| Molecular formula | C11H18O7 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | bis[(2-methylpropan-2-yl)oxycarbonyl] carbonate |
| InChIKey | YZVKCRIFBGZDNI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC(=O)OC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Di-tert-butyl tricarbonate, Tricarbonic acid, C,C'-bis(1,1-dimethylethyl) ester, diBoc-carbonate, Tricarbonic acid, bis(1,1-dimethylethyl) ester, Di-tert-butyl tricarbonate [MI], bis[(2-methylpropan-2-yl)oxycarbonyl] carbonate, di-t-butyl tricarbonate, di(tert-butyl) tricarbonate, bis(tert-butoxycarbonyl) carbonate, YZVKCRIFBGZDNI-UHFFFAOYSA-N