Products 2442510-29-2
CAS 2442510-29-2 is the registry number for Di-tert-butyl (2S,4R)-4-((methylamino)methyl)pyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (2S,4R)-4-(methylaminomethyl)pyrrolidine-1,2-dicarboxylate (CAS 2442510-29-2) is a chemical compound with the molecular formula C16H30N2O4 and a molecular weight of 314.42 g/mol. IUPAC name: ditert-butyl (2S,4R)-4-(methylaminomethyl)pyrrolidine-1,2-dicarboxylate. InChIKey: ODDXWXBWFVAQPM-NEPJUHHUSA-N.
| Molecular formula | C16H30N2O4 |
|---|---|
| Molecular weight | 314.42 g/mol |
| IUPAC name | ditert-butyl (2S,4R)-4-(methylaminomethyl)pyrrolidine-1,2-dicarboxylate |
| InChIKey | ODDXWXBWFVAQPM-NEPJUHHUSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](CN1C(=O)OC(C)(C)C)CNC |
Computed by PubChem (NCBI)