CAS 2442511-70-6 is the registry number for Di-tert-butyl (2S,4S)-4-(3-bromobenzyl)pyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ditert-butyl (2S,4S)-4-[(3-bromophenyl)methyl]pyrrolidine-1,2-dicarboxylate (CAS 2442511-70-6) is a chemical compound with the molecular formula C21H30BrNO4 and a molecular weight of 440.4 g/mol. IUPAC name: ditert-butyl (2S,4S)-4-[(3-bromophenyl)methyl]pyrrolidine-1,2-dicarboxylate. InChIKey: HMPMDYRJIQQLGB-RDJZCZTQSA-N.
| Molecular formula | C21H30BrNO4 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | ditert-butyl (2S,4S)-4-[(3-bromophenyl)methyl]pyrrolidine-1,2-dicarboxylate |
| InChIKey | HMPMDYRJIQQLGB-RDJZCZTQSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](CN1C(=O)OC(C)(C)C)CC2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)