CAS 2443360-60-7 is the registry number for SARS-CoV-2 Mpro-IN-28. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl (2S)-3-methyl-2-(3-oxo-1,2-benzoselenazol-2-yl)butanoate (CAS 2443360-60-7) is a chemical compound with the molecular formula C14H17NO3Se and a molecular weight of 326.26 g/mol. IUPAC name: ethyl (2S)-3-methyl-2-(3-oxo-1,2-benzoselenazol-2-yl)butanoate. InChIKey: WQFJCFHVNOOXSF-LBPRGKRZSA-N.
| Molecular formula | C14H17NO3Se |
|---|---|
| Molecular weight | 326.26 g/mol |
| IUPAC name | ethyl (2S)-3-methyl-2-(3-oxo-1,2-benzoselenazol-2-yl)butanoate |
| InChIKey | WQFJCFHVNOOXSF-LBPRGKRZSA-N |
| SMILES | CCOC(=O)[C@H](C(C)C)N1C(=O)C2=CC=CC=C2[Se]1 |
Computed by PubChem (NCBI)