CAS 2443473-68-3 is the registry number for 1-Hydroxy-3-methyl-2-phenyl-1H-benzo[d]imidazol-3-ium tetrafluoroborate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-hydroxy-3-methyl-2-phenylbenzimidazol-3-ium tetrafluoroborate (CAS 2443473-68-3) is a chemical compound with the molecular formula C14H13BF4N2O and a molecular weight of 312.07 g/mol. IUPAC name: 1-hydroxy-3-methyl-2-phenylbenzimidazol-3-ium tetrafluoroborate. InChIKey: XDZVNPNSUBVRRJ-UHFFFAOYSA-N.
| Molecular formula | C14H13BF4N2O |
|---|---|
| Molecular weight | 312.07 g/mol |
| IUPAC name | 1-hydroxy-3-methyl-2-phenylbenzimidazol-3-ium tetrafluoroborate |
| InChIKey | XDZVNPNSUBVRRJ-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C[N+]1=C(N(C2=CC=CC=C21)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)