CAS 2443488-37-5 is the registry number for 2-Bromo-8-(4-chlorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-8-(4-chlorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine (CAS 2443488-37-5) is a chemical compound with the molecular formula C12H11BrClN3O and a molecular weight of 328.59 g/mol. IUPAC name: 2-bromo-8-(4-chlorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: RPTTZDMBKHURRA-UHFFFAOYSA-N.
| Molecular formula | C12H11BrClN3O |
|---|---|
| Molecular weight | 328.59 g/mol |
| IUPAC name | 2-bromo-8-(4-chlorophenoxy)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | RPTTZDMBKHURRA-UHFFFAOYSA-N |
| SMILES | C1CC(C2=NC(=NN2C1)Br)OC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)