CAS 2444010-06-2 is the registry number for 2,2,4,7-Tetramethyl-4-(4-methylphenyl)-1,2,3,4-tetrahydroquinoline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,4,7-tetramethyl-4-(4-methylphenyl)-1,3-dihydroquinoline;hydrochloride (CAS 2444010-06-2) is a chemical compound with the molecular formula C20H26ClN and a molecular weight of 315.9 g/mol. IUPAC name: 2,2,4,7-tetramethyl-4-(4-methylphenyl)-1,3-dihydroquinoline;hydrochloride. InChIKey: BHFCGPCVKYDCLO-UHFFFAOYSA-N.
| Molecular formula | C20H26ClN |
|---|---|
| Molecular weight | 315.9 g/mol |
| IUPAC name | 2,2,4,7-tetramethyl-4-(4-methylphenyl)-1,3-dihydroquinoline;hydrochloride |
| InChIKey | BHFCGPCVKYDCLO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2(CC(NC3=C2C=CC(=C3)C)(C)C)C.Cl |
Computed by PubChem (NCBI)