CAS 24444-98-2 appears in our catalog under these names: 8-Thiatricyclo(7.4.0.0,2,7)trideca-1(9),2(7),10,12-tetraen-6-one, 95%, 8-Thiatricyclo(7.4.0.0,2,7)trideca-1(13),2(7),9,11-tetraen-6-one, 2,3-Dihydro-4(1H)-dibenzothiophenone, 97%, 97%, 2,3-Dihydro-4(1H)-dibenzothiophenone, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg, 250mg.
2,3-dihydro-1H-dibenzothiophen-4-one (CAS 24444-98-2) is a chemical compound with the molecular formula C12H10OS and a molecular weight of 202.27 g/mol. IUPAC name: 2,3-dihydro-1H-dibenzothiophen-4-one. InChIKey: DMESSBVCMGBSRF-UHFFFAOYSA-N.
| Molecular formula | C12H10OS |
|---|---|
| Molecular weight | 202.27 g/mol |
| IUPAC name | 2,3-dihydro-1H-dibenzothiophen-4-one |
| InChIKey | DMESSBVCMGBSRF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC3=CC=CC=C23 |
Computed by PubChem (NCBI)