Products 2444430-87-7
CAS 2444430-87-7 is the registry number for (1R,2R)-N1,N2-Dimethyl-1,2-di(naphthalen-2-yl)ethane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2R)-N,N'-dimethyl-1,2-dinaphthalen-2-ylethane-1,2-diamine (CAS 2444430-87-7) is a chemical compound with the molecular formula C24H24N2 and a molecular weight of 340.5 g/mol. IUPAC name: (1R,2R)-N,N'-dimethyl-1,2-dinaphthalen-2-ylethane-1,2-diamine. InChIKey: IHMFTXMBHJHPPQ-DNQXCXABSA-N.
| Molecular formula | C24H24N2 |
|---|---|
| Molecular weight | 340.5 g/mol |
| IUPAC name | (1R,2R)-N,N'-dimethyl-1,2-dinaphthalen-2-ylethane-1,2-diamine |
| InChIKey | IHMFTXMBHJHPPQ-DNQXCXABSA-N |
| SMILES | CN[C@H](C1=CC2=CC=CC=C2C=C1)[C@@H](C3=CC4=CC=CC=C4C=C3)NC |
Computed by PubChem (NCBI)