CAS 2445295-52-1 is the registry number for 1-(5-Chloro[1,1′-biphenyl]-3-yl)pyrene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-chloro-5-phenylphenyl)pyrene (CAS 2445295-52-1) is a chemical compound with the molecular formula C28H17Cl and a molecular weight of 388.9 g/mol. IUPAC name: 1-(3-chloro-5-phenylphenyl)pyrene. InChIKey: PQIJWUMFJQTHQR-UHFFFAOYSA-N.
| Molecular formula | C28H17Cl |
|---|---|
| Molecular weight | 388.9 g/mol |
| IUPAC name | 1-(3-chloro-5-phenylphenyl)pyrene |
| InChIKey | PQIJWUMFJQTHQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)C3=C4C=CC5=CC=CC6=C5C4=C(C=C6)C=C3 |
Computed by PubChem (NCBI)