Products 2445906-19-2
CAS 2445906-19-2 is the registry number for (1R)-6-Bromo-2,3,4,9-tetrahydro-N-(phenylmethyl)-1H-carbazol-1-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(1R)-N-benzyl-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine (CAS 2445906-19-2) is a chemical compound with the molecular formula C19H19BrN2 and a molecular weight of 355.3 g/mol. IUPAC name: (1R)-N-benzyl-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine. InChIKey: CCOWPQPKDFHXHZ-GOSISDBHSA-N.
| Molecular formula | C19H19BrN2 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | (1R)-N-benzyl-6-bromo-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| InChIKey | CCOWPQPKDFHXHZ-GOSISDBHSA-N |
| SMILES | C1C[C@H](C2=C(C1)C3=C(N2)C=CC(=C3)Br)NCC4=CC=CC=C4 |
Computed by PubChem (NCBI)