CAS 2446042-90-4 appears in our catalog under these names: (R)-L 888607, 97%, (R)–L 888607, (R)-L 888607, (R)-L 888607, 98%, 98%, (R)-L 888607, 99.69%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 5mg, 25mg, 50mg, 5 mg, 10mM/1mL.
2-[(3R)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid (CAS 2446042-90-4) is a chemical compound with the molecular formula C19H15ClFNO2S and a molecular weight of 375.8 g/mol. IUPAC name: 2-[(3R)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid. InChIKey: GSBAVONRPNJJOH-LLVKDONJSA-N.
| Molecular formula | C19H15ClFNO2S |
|---|---|
| Molecular weight | 375.8 g/mol |
| IUPAC name | 2-[(3R)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid |
| InChIKey | GSBAVONRPNJJOH-LLVKDONJSA-N |
| SMILES | C1CN2C3=C(C=CC(=C3)F)C(=C2[C@H]1CC(=O)O)SC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)