Products 860033-06-3

CAS 860033-06-3 appears in our catalog under these names: L 888607, 99+%, L 888607, L 888607, L 888607, 99.95%, 99.95%, L 888607, 99.87%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 1mg, 100 mg, 10mM/1mL.

Structural formula: {0} (CAS {1})

2-[(3S)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid (CAS 860033-06-3) is a chemical compound with the molecular formula C19H15ClFNO2S and a molecular weight of 375.8 g/mol. IUPAC name: 2-[(3S)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid. InChIKey: GSBAVONRPNJJOH-NSHDSACASA-N.

Identity
Molecular formulaC19H15ClFNO2S
Molecular weight375.8 g/mol
IUPAC name2-[(3S)-4-(4-chlorophenyl)sulfanyl-7-fluoro-2,3-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetic acid
InChIKeyGSBAVONRPNJJOH-NSHDSACASA-N
SMILESC1CN2C3=C(C=CC(=C3)F)C(=C2[C@@H]1CC(=O)O)SC4=CC=C(C=C4)Cl

Computed by PubChem (NCBI)