Products 2446063-14-3
CAS 2446063-14-3 is the registry number for α-Amylase/α-Glucosidase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-(4-chlorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine (CAS 2446063-14-3) is a chemical compound with the molecular formula C22H16ClN5 and a molecular weight of 385.8 g/mol. IUPAC name: N-[(E)-(4-chlorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine. InChIKey: XSJPJSDDBHODRT-BUVRLJJBSA-N.
| Molecular formula | C22H16ClN5 |
|---|---|
| Molecular weight | 385.8 g/mol |
| IUPAC name | N-[(E)-(4-chlorophenyl)methylideneamino]-5,6-diphenyl-1,2,4-triazin-3-amine |
| InChIKey | XSJPJSDDBHODRT-BUVRLJJBSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=NC(=N2)N/N=C/C3=CC=C(C=C3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)