CAS 244610-30-8 appears in our catalog under these names: (1R,5S)-6,6-Dimethylbicyclo(3.1.0)hexan-2-one, 95%, (1R,5S)-6,6-Dimethylbicyclo(3.1.0)hexan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(1R,5S)-6,6-dimethylbicyclo[3.1.0]hexan-2-one (CAS 244610-30-8) is a chemical compound with the molecular formula C8H12O and a molecular weight of 124.18 g/mol. IUPAC name: (1R,5S)-6,6-dimethylbicyclo[3.1.0]hexan-2-one. InChIKey: ZRKSYTSBZMCHBI-FSPLSTOPSA-N.
| Molecular formula | C8H12O |
|---|---|
| Molecular weight | 124.18 g/mol |
| IUPAC name | (1R,5S)-6,6-dimethylbicyclo[3.1.0]hexan-2-one |
| InChIKey | ZRKSYTSBZMCHBI-FSPLSTOPSA-N |
| SMILES | CC1([C@@H]2[C@H]1C(=O)CC2)C |
Computed by PubChem (NCBI)