Products 2446136-17-8
CAS 2446136-17-8 is the registry number for Aldose reductase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-fluoro-4-indol-1-ylsulfonylphenol (CAS 2446136-17-8) is a chemical compound with the molecular formula C14H10FNO3S and a molecular weight of 291.30 g/mol. IUPAC name: 2-fluoro-4-indol-1-ylsulfonylphenol. InChIKey: RNGRVWMFCJQROU-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO3S |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 2-fluoro-4-indol-1-ylsulfonylphenol |
| InChIKey | RNGRVWMFCJQROU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN2S(=O)(=O)C3=CC(=C(C=C3)O)F |
Computed by PubChem (NCBI)
Synonyms:
Aldose reductase-IN-4, orb1689425