CAS 2446874-39-9 is the registry number for 2-Chloro-N,N-bis(4-methoxybenzyl)-6-methylpyrimidin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N,N-bis[(4-methoxyphenyl)methyl]-6-methylpyrimidin-4-amine (CAS 2446874-39-9) is a chemical compound with the molecular formula C21H22ClN3O2 and a molecular weight of 383.9 g/mol. IUPAC name: 2-chloro-N,N-bis[(4-methoxyphenyl)methyl]-6-methylpyrimidin-4-amine. InChIKey: DFXQURZDGXZKDM-UHFFFAOYSA-N.
| Molecular formula | C21H22ClN3O2 |
|---|---|
| Molecular weight | 383.9 g/mol |
| IUPAC name | 2-chloro-N,N-bis[(4-methoxyphenyl)methyl]-6-methylpyrimidin-4-amine |
| InChIKey | DFXQURZDGXZKDM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)Cl)N(CC2=CC=C(C=C2)OC)CC3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)