CAS 2446913-88-6 appears in our catalog under these names: 1-(6-Bromo-1-methylindazol-3-yl)hexahyd&, 1-(6-Bromo-1-methyl-1H-indazol-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 98%, CRBN ligand-547, 99.83%, 1-(6-Bromo-1-methyl-1H-indazol-3-yl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Sigma-Aldrich, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1G, 50g, 100g, 250g, 100mg, 250mg, 500mg, 5g.
1-(6-bromo-1-methylindazol-3-yl)-1,3-diazinane-2,4-dione (CAS 2446913-88-6) is a chemical compound with the molecular formula C12H11BrN4O2 and a molecular weight of 323.15 g/mol. IUPAC name: 1-(6-bromo-1-methylindazol-3-yl)-1,3-diazinane-2,4-dione. InChIKey: FVEJZRXMQPIZQZ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrN4O2 |
|---|---|
| Molecular weight | 323.15 g/mol |
| IUPAC name | 1-(6-bromo-1-methylindazol-3-yl)-1,3-diazinane-2,4-dione |
| InChIKey | FVEJZRXMQPIZQZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=N1)N3CCC(=O)NC3=O |
Computed by PubChem (NCBI)