CAS 24470-78-8 appears in our catalog under these names: Isopropyltriphenylphosphonium Iodide, Isopropyltriphenylphosphonium Iodide, Isopropyltriphenylphosphonium iodide, 97+% , Isopropyltriphenylphosphonium iodide, 98%, Isopropyltriphenylphosphonium Iodide, >98.0%(HPLC)(T). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI. Available pack sizes: 10g, 50g, 5g, 100g, 500g, 250g, 25g, 1000g.
Triphenyl(propan-2-yl)phosphanium iodide (CAS 24470-78-8) is a chemical compound with the molecular formula C21H22IP and a molecular weight of 432.3 g/mol. IUPAC name: triphenyl(propan-2-yl)phosphanium iodide. InChIKey: HHBXWXJLQYJJBW-UHFFFAOYSA-M.
| Molecular formula | C21H22IP |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | triphenyl(propan-2-yl)phosphanium iodide |
| InChIKey | HHBXWXJLQYJJBW-UHFFFAOYSA-M |
| SMILES | CC(C)[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[I-] |
Computed by PubChem (NCBI)