CAS 24476-74-2 is the registry number for trans-Dichlorobis(4-chloropyridine)platinum, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(4-chloropyridine);dichloroplatinum (CAS 24476-74-2) is a chemical compound with the molecular formula C10H8Cl4N2Pt and a molecular weight of 493.1 g/mol. IUPAC name: bis(4-chloropyridine);dichloroplatinum. InChIKey: YGHCNZXRJBCDLV-UHFFFAOYSA-L.
| Molecular formula | C10H8Cl4N2Pt |
|---|---|
| Molecular weight | 493.1 g/mol |
| IUPAC name | bis(4-chloropyridine);dichloroplatinum |
| InChIKey | YGHCNZXRJBCDLV-UHFFFAOYSA-L |
| SMILES | C1=CN=CC=C1Cl.C1=CN=CC=C1Cl.Cl[Pt]Cl |
Computed by PubChem (NCBI)