CAS 24476-79-7 is the registry number for Bis(2-quinolinecarboxylato-κN1,κO2)copper, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper bis(quinoline-2-carboxylate) (CAS 24476-79-7) is a chemical compound with the molecular formula C20H12CuN2O4 and a molecular weight of 407.9 g/mol. IUPAC name: copper bis(quinoline-2-carboxylate). InChIKey: JLOULEJYJNBUMX-UHFFFAOYSA-L.
| Molecular formula | C20H12CuN2O4 |
|---|---|
| Molecular weight | 407.9 g/mol |
| IUPAC name | copper bis(quinoline-2-carboxylate) |
| InChIKey | JLOULEJYJNBUMX-UHFFFAOYSA-L |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(=O)[O-].C1=CC=C2C(=C1)C=CC(=N2)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)