CAS 244761-29-3 appears in our catalog under these names: Lithium bis(oxalate)borate, 95%, Lithium 2,3,7,8–tetraoxo–1,4,6,9–tetraoxa–5–boraspiro(4·4)nonan–5–uide, Lithium Bis(oxalate)borate, >95.0%(T), Lithium 2,3,7,8-tetraoxo-1,4,6,9-tetraoxa-5-boraspiro[4.4]nonan-5-uide 95%, LITHIUM BIS(OXALATE)BORATE. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 100g, 5g, 1g, 500g, 50G.
Lithium 1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonane-2,3,7,8-tetrone (CAS 244761-29-3) is a chemical compound with the molecular formula C4BLiO8 and a molecular weight of 193.8 g/mol. IUPAC name: lithium 1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonane-2,3,7,8-tetrone. InChIKey: NVQAYVUCVASGDK-UHFFFAOYSA-N.
| Molecular formula | C4BLiO8 |
|---|---|
| Molecular weight | 193.8 g/mol |
| IUPAC name | lithium 1,4,6,9-tetraoxa-5-boranuidaspiro[4.4]nonane-2,3,7,8-tetrone |
| InChIKey | NVQAYVUCVASGDK-UHFFFAOYSA-N |
| SMILES | [Li+].[B-]12(OC(=O)C(=O)O1)OC(=O)C(=O)O2 |
Computed by PubChem (NCBI)