Products 2447686-91-9
CAS 2447686-91-9 is the registry number for 5-Bromo-2-methyl-2H-indazole-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-2-(trideuteriomethyl)indazole (CAS 2447686-91-9) is a chemical compound with the molecular formula C8H7BrN2 and a molecular weight of 214.08 g/mol. IUPAC name: 5-bromo-2-(trideuteriomethyl)indazole. InChIKey: QFZOHVHNTZTZMJ-FIBGUPNXSA-N.
| Molecular formula | C8H7BrN2 |
|---|---|
| Molecular weight | 214.08 g/mol |
| IUPAC name | 5-bromo-2-(trideuteriomethyl)indazole |
| InChIKey | QFZOHVHNTZTZMJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=C2C=C(C=CC2=N1)Br |
Computed by PubChem (NCBI)