CAS 24482-75-5 is the registry number for Ethyl 2,2-Dichloro-2-nitroacetate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Ethyl 2,2-dichloro-2-nitroacetate (CAS 24482-75-5) is a chemical compound with the molecular formula C4H5Cl2NO4 and a molecular weight of 201.99 g/mol. IUPAC name: ethyl 2,2-dichloro-2-nitroacetate. InChIKey: BQNLRKAHUIBXDJ-UHFFFAOYSA-N.
| Molecular formula | C4H5Cl2NO4 |
|---|---|
| Molecular weight | 201.99 g/mol |
| IUPAC name | ethyl 2,2-dichloro-2-nitroacetate |
| InChIKey | BQNLRKAHUIBXDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C([N+](=O)[O-])(Cl)Cl |
Computed by PubChem (NCBI)