Products 24482-75-5

CAS 24482-75-5 is the registry number for Ethyl 2,2-Dichloro-2-nitroacetate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2,2-dichloro-2-nitroacetate (CAS 24482-75-5) is a chemical compound with the molecular formula C4H5Cl2NO4 and a molecular weight of 201.99 g/mol. IUPAC name: ethyl 2,2-dichloro-2-nitroacetate. InChIKey: BQNLRKAHUIBXDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H5Cl2NO4
Molecular weight201.99 g/mol
IUPAC nameethyl 2,2-dichloro-2-nitroacetate
InChIKeyBQNLRKAHUIBXDJ-UHFFFAOYSA-N
SMILESCCOC(=O)C([N+](=O)[O-])(Cl)Cl

Computed by PubChem (NCBI)