CAS 245116-90-9 appears in our catalog under these names: Lidorestat, 95%, Lidorestat, 1H-Indole-1-aceticacid, 3-[(4,5,7-trifluoro-2-benzothiazolyl)methyl]-, 95%, 95%, Lidorestat, 99.50%, 2-(3-((4,5,7-TRIFLUOROBENZO[D]THIAZOL-2-YL)METHYL)-1H-INDOL-1-YL)ACETIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg.
2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]indol-1-yl]acetic acid (CAS 245116-90-9) is a chemical compound with the molecular formula C18H11F3N2O2S and a molecular weight of 376.4 g/mol. IUPAC name: 2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]indol-1-yl]acetic acid. InChIKey: KYHVTMFADJNSGS-UHFFFAOYSA-N.
| Molecular formula | C18H11F3N2O2S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 2-[3-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]indol-1-yl]acetic acid |
| InChIKey | KYHVTMFADJNSGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC(=O)O)CC3=NC4=C(C(=CC(=C4S3)F)F)F |
Computed by PubChem (NCBI)