Products 2451455-98-2
CAS 2451455-98-2 is the registry number for 4–acetoxy TMT (iodide). Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-(4-acetyloxy-1H-indol-3-yl)ethyl-trimethylazanium iodide (CAS 2451455-98-2) is a chemical compound with the molecular formula C15H21IN2O2 and a molecular weight of 388.24 g/mol. IUPAC name: 2-(4-acetyloxy-1H-indol-3-yl)ethyl-trimethylazanium iodide. InChIKey: MTXCVVIYLGOXRG-UHFFFAOYSA-M.
| Molecular formula | C15H21IN2O2 |
|---|---|
| Molecular weight | 388.24 g/mol |
| IUPAC name | 2-(4-acetyloxy-1H-indol-3-yl)ethyl-trimethylazanium iodide |
| InChIKey | MTXCVVIYLGOXRG-UHFFFAOYSA-M |
| SMILES | CC(=O)OC1=CC=CC2=C1C(=CN2)CC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)