CAS 2451455-99-3 appears in our catalog under these names: 4-Hydroxy TMT (Iodide), 4–hydroxy TMT (iodide). Offered by: Chemat Brand, GLPBio. Available pack sizes: on request, 1mg, 5mg.
2-(4-hydroxy-1H-indol-3-yl)ethyl-trimethylazanium iodide (CAS 2451455-99-3) is a chemical compound with the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. IUPAC name: 2-(4-hydroxy-1H-indol-3-yl)ethyl-trimethylazanium iodide. InChIKey: QNUXJABHEYPNKW-UHFFFAOYSA-N.
| Molecular formula | C13H19IN2O |
|---|---|
| Molecular weight | 346.21 g/mol |
| IUPAC name | 2-(4-hydroxy-1H-indol-3-yl)ethyl-trimethylazanium iodide |
| InChIKey | QNUXJABHEYPNKW-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CCC1=CNC2=C1C(=CC=C2)O.[I-] |
Computed by PubChem (NCBI)