Products 2451479-58-4
CAS 2451479-58-4 is the registry number for hCAIX-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(3-fluorophenyl)-N-(2-oxochromen-6-yl)prop-2-enamide (CAS 2451479-58-4) is a chemical compound with the molecular formula C18H12FNO3 and a molecular weight of 309.3 g/mol. IUPAC name: (E)-3-(3-fluorophenyl)-N-(2-oxochromen-6-yl)prop-2-enamide. InChIKey: OXJBLRCFWGEKML-XBXARRHUSA-N.
| Molecular formula | C18H12FNO3 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | (E)-3-(3-fluorophenyl)-N-(2-oxochromen-6-yl)prop-2-enamide |
| InChIKey | OXJBLRCFWGEKML-XBXARRHUSA-N |
| SMILES | C1=CC(=CC(=C1)F)/C=C/C(=O)NC2=CC3=C(C=C2)OC(=O)C=C3 |
Computed by PubChem (NCBI)