Products 2451500-46-0
CAS 2451500-46-0 is the registry number for 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2,7-diol, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2,7-diol (CAS 2451500-46-0) is a chemical compound with the molecular formula C16H19BO4 and a molecular weight of 286.1 g/mol. IUPAC name: 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2,7-diol. InChIKey: SOZGCLLWIJAIFB-UHFFFAOYSA-N.
| Molecular formula | C16H19BO4 |
|---|---|
| Molecular weight | 286.1 g/mol |
| IUPAC name | 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-2,7-diol |
| InChIKey | SOZGCLLWIJAIFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C(C=C3)O)C=C2O |
Computed by PubChem (NCBI)