Products 2453228-45-8
CAS 2453228-45-8 is the registry number for Anticancer agent 71. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(2-amino-6-phenylpyrimidin-4-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea (CAS 2453228-45-8) is a chemical compound with the molecular formula C18H13ClF3N5O and a molecular weight of 407.8 g/mol. IUPAC name: 1-(2-amino-6-phenylpyrimidin-4-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea. InChIKey: HQDVZDXIFMCLAZ-UHFFFAOYSA-N.
| Molecular formula | C18H13ClF3N5O |
|---|---|
| Molecular weight | 407.8 g/mol |
| IUPAC name | 1-(2-amino-6-phenylpyrimidin-4-yl)-3-[4-chloro-3-(trifluoromethyl)phenyl]urea |
| InChIKey | HQDVZDXIFMCLAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC(=N2)N)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 71, orb1687994