CAS 245325-05-7 is the registry number for Diethyl (3,5-bis(trifluoromethyl)phenyl)phosphonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-diethoxyphosphoryl-3,5-bis(trifluoromethyl)benzene (CAS 245325-05-7) is a chemical compound with the molecular formula C12H13F6O3P and a molecular weight of 350.19 g/mol. IUPAC name: 1-diethoxyphosphoryl-3,5-bis(trifluoromethyl)benzene. InChIKey: DCIKXASZLQVPMA-UHFFFAOYSA-N.
| Molecular formula | C12H13F6O3P |
|---|---|
| Molecular weight | 350.19 g/mol |
| IUPAC name | 1-diethoxyphosphoryl-3,5-bis(trifluoromethyl)benzene |
| InChIKey | DCIKXASZLQVPMA-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)OCC |
Computed by PubChem (NCBI)