CAS 24536-68-3 is the registry number for Rasagiline Impurity 27. Offered by: Chemat Brand. Available pack sizes: on request.
(3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene (CAS 24536-68-3) is a chemical compound with the molecular formula C18H16 and a molecular weight of 232.3 g/mol. IUPAC name: (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene. InChIKey: HLSBTOHZBUYMFU-ISLYRVAYSA-N.
| Molecular formula | C18H16 |
|---|---|
| Molecular weight | 232.3 g/mol |
| IUPAC name | (3E)-3-(2,3-dihydroinden-1-ylidene)-1,2-dihydroindene |
| InChIKey | HLSBTOHZBUYMFU-ISLYRVAYSA-N |
| SMILES | C1C/C(=C\2/CCC3=CC=CC=C32)/C4=CC=CC=C41 |
Computed by PubChem (NCBI)