CAS 2454019-69-1 appears in our catalog under these names: NLRP3 agonist 1, NLRP3 agonist 1, 99.47%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 25 mg, 50 mg, 5 mg.
4-N-(1-methylcyclopropyl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine (CAS 2454019-69-1) is a chemical compound with the molecular formula C15H16N6 and a molecular weight of 280.33 g/mol. IUPAC name: 4-N-(1-methylcyclopropyl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine. InChIKey: KNPJIDCHCYGPIK-UHFFFAOYSA-N.
| Molecular formula | C15H16N6 |
|---|---|
| Molecular weight | 280.33 g/mol |
| IUPAC name | 4-N-(1-methylcyclopropyl)-7-(1H-pyrazol-5-yl)quinazoline-2,4-diamine |
| InChIKey | KNPJIDCHCYGPIK-UHFFFAOYSA-N |
| SMILES | CC1(CC1)NC2=NC(=NC3=C2C=CC(=C3)C4=CC=NN4)N |
Computed by PubChem (NCBI)