CAS 24541-19-3 appears in our catalog under these names: 4,4'-Dimethylbianthrone, 95%, 4,4'-Dimethylbianthrone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 50mg, 25mg, 250mg, 500mg.
(10Z)-4-methyl-10-(1-methyl-10-oxoanthracen-9-ylidene)anthracen-9-one (CAS 24541-19-3) is a chemical compound with the molecular formula C30H20O2 and a molecular weight of 412.5 g/mol. IUPAC name: (10Z)-4-methyl-10-(1-methyl-10-oxoanthracen-9-ylidene)anthracen-9-one. InChIKey: JZJAAPULINRLRZ-DQSJHHFOSA-N.
| Molecular formula | C30H20O2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | (10Z)-4-methyl-10-(1-methyl-10-oxoanthracen-9-ylidene)anthracen-9-one |
| InChIKey | JZJAAPULINRLRZ-DQSJHHFOSA-N |
| SMILES | CC1=C\2C(=CC=C1)C(=O)C3=CC=CC=C3/C2=C/4\C5=CC=CC=C5C(=O)C6=CC=CC(=C64)C |
Computed by PubChem (NCBI)