CAS 24541-43-3 is the registry number for 4-Azidophenol, 99.83%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg.
4-azidophenol (CAS 24541-43-3) is a chemical compound with the molecular formula C6H5N3O and a molecular weight of 135.12 g/mol. IUPAC name: 4-azidophenol. InChIKey: ABSZNIJDTSIVHN-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O |
|---|---|
| Molecular weight | 135.12 g/mol |
| IUPAC name | 4-azidophenol |
| InChIKey | ABSZNIJDTSIVHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+]=[N-])O |
Computed by PubChem (NCBI)