CAS 2454100-44-6 is the registry number for (S,E)-5-Amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one (E/Z Mixture). Offered by: TRC. Available pack sizes: 100mg.
(E,2S)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one (CAS 2454100-44-6) is a chemical compound with the molecular formula C32H32N2O and a molecular weight of 460.6 g/mol. IUPAC name: (E,2S)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one. InChIKey: IVYLNCUETJNNJU-XTOPAKSLSA-N.
| Molecular formula | C32H32N2O |
|---|---|
| Molecular weight | 460.6 g/mol |
| IUPAC name | (E,2S)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one |
| InChIKey | IVYLNCUETJNNJU-XTOPAKSLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)/C=C(\CC2=CC=CC=C2)/N)N(CC3=CC=CC=C3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)