Products 2454115-43-4
CAS 2454115-43-4 is the registry number for Antileishmanial agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-bromophenyl)-[1-(4-bromophenyl)triazol-4-yl]methanol (CAS 2454115-43-4) is a chemical compound with the molecular formula C15H11Br2N3O and a molecular weight of 409.07 g/mol. IUPAC name: (4-bromophenyl)-[1-(4-bromophenyl)triazol-4-yl]methanol. InChIKey: ADBZXYOFJKVXLD-UHFFFAOYSA-N.
| Molecular formula | C15H11Br2N3O |
|---|---|
| Molecular weight | 409.07 g/mol |
| IUPAC name | (4-bromophenyl)-[1-(4-bromophenyl)triazol-4-yl]methanol |
| InChIKey | ADBZXYOFJKVXLD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CN(N=N2)C3=CC=C(C=C3)Br)O)Br |
Computed by PubChem (NCBI)
Synonyms:
Antileishmanial agent-1, orb1690825