Products 2454396-60-0
CAS 2454396-60-0 is the registry number for 2,3-Dichloro-5-iodopyridin-4-amine, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3-dichloro-5-iodopyridin-4-amine (CAS 2454396-60-0) is a chemical compound with the molecular formula C5H3Cl2IN2 and a molecular weight of 288.90 g/mol. IUPAC name: 2,3-dichloro-5-iodopyridin-4-amine. InChIKey: QPUIIHAJXRUSKH-UHFFFAOYSA-N.
| Molecular formula | C5H3Cl2IN2 |
|---|---|
| Molecular weight | 288.90 g/mol |
| IUPAC name | 2,3-dichloro-5-iodopyridin-4-amine |
| InChIKey | QPUIIHAJXRUSKH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)Cl)Cl)N)I |
Computed by PubChem (NCBI)