CAS 2454491-14-4 is the registry number for 4,7-Dichloro-8-fluoro-2-(methylthio)pyrido[4,3-d]pyrimidine, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine (CAS 2454491-14-4) is a chemical compound with the molecular formula C8H4Cl2FN3S and a molecular weight of 264.11 g/mol. IUPAC name: 4,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine. InChIKey: QOZFRTHMDJLTPB-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2FN3S |
|---|---|
| Molecular weight | 264.11 g/mol |
| IUPAC name | 4,7-dichloro-8-fluoro-2-methylsulfanylpyrido[4,3-d]pyrimidine |
| InChIKey | QOZFRTHMDJLTPB-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=NC=C2C(=N1)Cl)Cl)F |
Computed by PubChem (NCBI)