CAS 24545-86-6 appears in our catalog under these names: 4',5'–DINITROFLUORESCEIN, 3′,6′-Dihydroxy-4′,5′-dinitrospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one, Dye content 85 %, Dye content 85 %. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
3',6'-dihydroxy-4',5'-dinitrospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 24545-86-6) is a chemical compound with the molecular formula C20H10N2O9 and a molecular weight of 422.3 g/mol. IUPAC name: 3',6'-dihydroxy-4',5'-dinitrospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: RYCIBGACBRAXBM-UHFFFAOYSA-N.
| Molecular formula | C20H10N2O9 |
|---|---|
| Molecular weight | 422.3 g/mol |
| IUPAC name | 3',6'-dihydroxy-4',5'-dinitrospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | RYCIBGACBRAXBM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)[N+](=O)[O-])OC5=C3C=CC(=C5[N+](=O)[O-])O |
Computed by PubChem (NCBI)