CAS 245539-10-0 appears in our catalog under these names: 1,4-Dichloro-2-isocyano-benzene, 95%, 2,5-Dichlorophenylisocyanide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1,4-dichloro-2-isocyanobenzene (CAS 245539-10-0) is a chemical compound with the molecular formula C7H3Cl2N and a molecular weight of 172.01 g/mol. IUPAC name: 1,4-dichloro-2-isocyanobenzene. InChIKey: XWTFRFDJAYBRHE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2N |
|---|---|
| Molecular weight | 172.01 g/mol |
| IUPAC name | 1,4-dichloro-2-isocyanobenzene |
| InChIKey | XWTFRFDJAYBRHE-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)